| Name | hexacosanoic acid |
| Synonyms | Cerotinsαure Ceratinic acid Hexacosanic acid hexacosanoic acid |
| CAS | 506-46-7 |
| EINECS | 208-040-2 |
| InChI | InChI=1/C26H52O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h2-25H2,1H3,(H,27,28) |
| Molecular Formula | C26H52O |
| Molar Mass | 396.69 |
| Density | 0.876g/cm3 |
| Melting Point | 84-88 °C |
| Boling Point | 418.7°C at 760 mmHg |
| Flash Point | 187.6°C |
| Solubility | Insoluble in water, soluble in hot alcohol, benzene, ether, chloroform, carbon disulfide and acetone, slightly soluble in cold alcohol. |
| Vapor Presure | 9.26E-08mmHg at 25°C |
| Appearance | Shape Shiny Fluffy or Crystalline Powder, color White |
| pKa | 4.78±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.46 |
| MDL | MFCD00002811 |
| Physical and Chemical Properties | EPA Chemical Material Information Hexacosanoic acid (506-46-7) |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| HS Code | 29159000 |
| Raw Materials | Hexacosanenitrile Undecanoic acid, 11-iodo-, methyl ester 1-HEXACOSANOL 1-BROMOPENTADECANE Myristoyl chloride Ethanol 1-Nonanol |
| Downstream Products | 1-Triacontanol METHYL HEXACOSANOATE |
| BRN | 1799681 |
biological activity
Hexacosanoic acid is a long-chain fatty acid, which is associated with a variety of diseases, such as adrenal leukodystrophy (ALD), adrenal myelin disease (AMN) and atherosclerosis.
target
Human Endogenous Metabolite